2-Pyridineethanol, a-(3-chlorophenyl)-a-methyl-b-phenyl-
Modify Date: 2025-09-01 14:16:10
2-Pyridineethanol, a-(3-chlorophenyl)-a-methyl-b-phenyl- structure
|
Common Name | 2-Pyridineethanol, a-(3-chlorophenyl)-a-methyl-b-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 13997-39-2 | Molecular Weight | 323.81600 | |
| Density | 1.213g/cm3 | Boiling Point | 422.4ºC at 760mmHg | |
| Molecular Formula | C20H18ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.3ºC | |
| Name | 2-(3-chlorophenyl)-1-phenyl-1-pyridin-2-ylpropan-2-ol |
|---|
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 422.4ºC at 760mmHg |
| Molecular Formula | C20H18ClNO |
| Molecular Weight | 323.81600 |
| Flash Point | 209.3ºC |
| Exact Mass | 323.10800 |
| PSA | 33.12000 |
| LogP | 4.77460 |
| Vapour Pressure | 6.85E-08mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | SIQJKXNPTOTGHR-UHFFFAOYSA-N |
| SMILES | CC(O)(c1cccc(Cl)c1)C(c1ccccc1)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |