Metalaxyl-M-d6 structure
|
Common Name | Metalaxyl-M-d6 | ||
|---|---|---|---|---|
| CAS Number | 1398112-32-7 | Molecular Weight | 285.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15D6NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Metalaxyl-M-d6Metalaxyl-M-d6 is the deuterium labeled Metalaxyl-M[1]. Metalaxyl-M ((R)-Metalaxyl) is the active (R)-enantiomer of Metalaxyl. Metalaxyl-M is a broad-spectrum fungicide that inhibits protein and ribosomal RNA synthesis in?fungi. Metalaxyl is used for research of plant diseases caused by pathogens of the Oomycota division[2]. |
| Name | Metalaxyl-M-d6 |
|---|
| Description | Metalaxyl-M-d6 is the deuterium labeled Metalaxyl-M[1]. Metalaxyl-M ((R)-Metalaxyl) is the active (R)-enantiomer of Metalaxyl. Metalaxyl-M is a broad-spectrum fungicide that inhibits protein and ribosomal RNA synthesis in?fungi. Metalaxyl is used for research of plant diseases caused by pathogens of the Oomycota division[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C15H15D6NO4 |
|---|---|
| Molecular Weight | 285.37 |
| InChIKey | ZQEIXNIJLIKNTD-GMGXQYKBSA-N |
| SMILES | COCC(=O)N(c1c(C)cccc1C)C(C)C(=O)OC |