Methylsyringin structure
|
Common Name | Methylsyringin | ||
|---|---|---|---|---|
| CAS Number | 139742-20-4 | Molecular Weight | 386.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MethylsyringinMethylsyringin exhibits anti-inflammatory activity in the LPS-stimulated RAW264.7 cells. |
| Name | Methylsyringin |
|---|
| Description | Methylsyringin exhibits anti-inflammatory activity in the LPS-stimulated RAW264.7 cells. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H26O9 |
|---|---|
| Molecular Weight | 386.39 |
| InChIKey | KDZYNPVXUQIVAO-LSUNSJSKSA-N |
| SMILES | COCC=Cc1cc(OC)c(OC2OC(CO)C(O)C(O)C2O)c(OC)c1 |