1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-allylcarbamate structure
|
Common Name | 1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-allylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 13973-71-2 | Molecular Weight | 279.28800 | |
| Density | 1.241g/cm3 | Boiling Point | 450.2ºC at 760 mmHg | |
| Molecular Formula | C14H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.1ºC | |
| Name | 2-(2,3-Dihydro-1,4-benzodioxin-2-yl)-2-hydroxyethyl allylcarbamat e |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 450.2ºC at 760 mmHg |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.28800 |
| Flash Point | 226.1ºC |
| Exact Mass | 279.11100 |
| PSA | 80.51000 |
| LogP | 1.30390 |
| Vapour Pressure | 6.85E-09mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | VCTNHPKSHQKNAO-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)OCC(O)C1COc2ccccc2O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-acridin-9-ylamino-5-methanesulfonylamino-phenoxy)-ethanol |
| Methanesulfonamide,N-(4-(9-acridinylamino)-3-(2-hydroxyethoxy)phenyl) |
| 2-(2-Allylcarbamoyloxy-1-hydroxyethyl)-1,4-benzodioxan |
| N-(4-(9-Acridinylamino)-3-(2-hydroxyethoxy)phenyl)methanesulfonamide |