KNI-102
Modify Date: 2025-09-14 18:53:01
KNI-102 structure
|
Common Name | KNI-102 | ||
|---|---|---|---|---|
| CAS Number | 139694-65-8 | Molecular Weight | 595.68700 | |
| Density | 1.262g/cm3 | Boiling Point | 964.2ºC at 760mmHg | |
| Molecular Formula | C31H41N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 536.9ºC | |
Use of KNI-102KNI-102 is a potent anti-HIV agent with an IC50 value of 100 nM for HIV protease[1]. |
| Name | benzyl N-[(2S)-4-amino-1-[[(2S,3S)-4-[(2S)-2-(tert-butylcarbamoyl)pyrrolidin-1-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | KNI-102 is a potent anti-HIV agent with an IC50 value of 100 nM for HIV protease[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 964.2ºC at 760mmHg |
| Molecular Formula | C31H41N5O7 |
| Molecular Weight | 595.68700 |
| Flash Point | 536.9ºC |
| Exact Mass | 595.30100 |
| PSA | 191.62000 |
| LogP | 4.12350 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | XCVUOCMQYKSJJR-IGRGDXOOSA-N |
| SMILES | CC(C)(C)NC(=O)C1CCCN1C(=O)C(O)C(Cc1ccccc1)NC(=O)C(CC(N)=O)NC(=O)OCc1ccccc1 |
CAS#:3256-57-3
CAS#:128018-18-8
CAS#:1148-11-4
CAS#:68030-64-8| Rpi 312 |
| (S)-N-tert-butyl-3-[(2S,3S)-2-hydroxy-3-[(S)-2-benzyloxycarbonylaminosuccinamyl]amino-4-phenylbutanoyl]pyrrolidine-2-carboxamide |
| AHPBA 1a |
| Z-Asn-apns-pro-NH-t-but |
| Cbz-Asn-Apns-Pro-NH-tBu |
| Kni-102 |