2-(dimethylamino)ethyl 3-amino-4-chlorobenzoate
Modify Date: 2025-09-05 14:34:14
2-(dimethylamino)ethyl 3-amino-4-chlorobenzoate structure
|
Common Name | 2-(dimethylamino)ethyl 3-amino-4-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 13930-34-2 | Molecular Weight | 242.70200 | |
| Density | 1.223g/cm3 | Boiling Point | 358.2ºC at 760mmHg | |
| Molecular Formula | C11H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | 2-(dimethylamino)ethyl 3-amino-4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 358.2ºC at 760mmHg |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.70200 |
| Flash Point | 170.5ºC |
| Exact Mass | 242.08200 |
| PSA | 55.56000 |
| LogP | 2.22180 |
| Vapour Pressure | 2.58E-05mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | BMDZNGISRKXXIF-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(=O)c1ccc(Cl)c(N)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Clormecaina |
| Clormecainum |
| clormecaine |
| UNII-RR5R8BAX26 |