Cyantraniliprole D3
Modify Date: 2024-01-05 11:55:18
Cyantraniliprole D3 structure
|
Common Name | Cyantraniliprole D3 | ||
|---|---|---|---|---|
| CAS Number | 1392493-34-3 | Molecular Weight | 476.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H11D3BrClN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cyantraniliprole D3Cyantraniliprole D3 is the deuterium labeled Cyantraniliprole, which is an insecticide of the ryanoid class. |
| Name | Cyantraniliprole D3 |
|---|
| Description | Cyantraniliprole D3 is the deuterium labeled Cyantraniliprole, which is an insecticide of the ryanoid class. |
|---|---|
| Related Catalog |
| Molecular Formula | C19H11D3BrClN6O2 |
|---|---|
| Molecular Weight | 476.73 |
| InChIKey | DVBUIBGJRQBEDP-BMSJAHLVSA-N |
| SMILES | CNC(=O)c1cc(C#N)cc(C)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| Storage condition | 2-8℃ |