Benzoic acid, 4-[[[ (2-chloroethyl)nitrosoamino]carbonyl]amino]
Modify Date: 2024-09-18 14:58:33
![Benzoic acid, 4-[[[ (2-chloroethyl)nitrosoamino]carbonyl]amino] Structure](https://image.chemsrc.com/caspic/449/13909-25-6.png)
Benzoic acid, 4-[[[ (2-chloroethyl)nitrosoamino]carbonyl]amino] structure
|
Common Name | Benzoic acid, 4-[[[ (2-chloroethyl)nitrosoamino]carbonyl]amino] | ||
|---|---|---|---|---|
| CAS Number | 13909-25-6 | Molecular Weight | 271.65700 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C10H10ClN3O4 |
| Molecular Weight | 271.65700 |
| Exact Mass | 271.03600 |
| PSA | 99.07000 |
| LogP | 2.21190 |
| Index of Refraction | 1.615 |
| InChIKey | XXPHTAWBJVUIOY-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)C(=O)Nc1ccc(C(=O)O)cc1 |
|
~%
Benzoic acid, 4... CAS#:13909-25-6 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
|
~%
Benzoic acid, 4... CAS#:13909-25-6 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
![Benzoic acid,4-[[[(2-chloroethyl)amino]carbonyl]amino]- structure](https://image.chemsrc.com/caspic/343/13908-46-8.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-({[(2-chloroethyl)nitrosoamino]carbonyl}amino)-benzoic acid |
| 4-{[(2-chloroethyl)(nitroso)carbamoyl]amino}benzoic acid |
| Benzoic acid,p-(3-(2-chloroethyl)nitrosoureido) |