Benzoicacid, 3,5-bis[[[(2-chloroethyl)amino]carbonyl]amino]- structure
|
Common Name | Benzoicacid, 3,5-bis[[[(2-chloroethyl)amino]carbonyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 13908-68-4 | Molecular Weight | 363.19700 | |
| Density | 1.503g/cm3 | Boiling Point | 530.5ºC at 760mmHg | |
| Molecular Formula | C13H16Cl2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.6ºC | |
| Name | 3,5-bis(2-chloroethylcarbamoylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.503g/cm3 |
|---|---|
| Boiling Point | 530.5ºC at 760mmHg |
| Molecular Formula | C13H16Cl2N4O4 |
| Molecular Weight | 363.19700 |
| Flash Point | 274.6ºC |
| Exact Mass | 362.05500 |
| PSA | 119.56000 |
| LogP | 3.03320 |
| Vapour Pressure | 4.4E-12mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | FCDHURWVHIWHQP-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)Nc1cc(NC(=O)NCCCl)cc(C(=O)O)c1 |
|
~%
Benzoicacid, 3,... CAS#:13908-68-4 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3,5-bis{[(2-chloroethyl)carbamoyl]amino}benzoic acid |