1-(2,4,5-triphenyl-1H-pyrrol-3-yl)ethanone structure
|
Common Name | 1-(2,4,5-triphenyl-1H-pyrrol-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 13901-75-2 | Molecular Weight | 337.41400 | |
| Density | 1.143g/cm3 | Boiling Point | 534.5ºC at 760 mmHg | |
| Molecular Formula | C24H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.7ºC | |
| Name | 1-(2,4,5-triphenyl-1H-pyrrol-3-yl)ethanone |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 534.5ºC at 760 mmHg |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.41400 |
| Flash Point | 275.7ºC |
| Exact Mass | 337.14700 |
| PSA | 32.86000 |
| LogP | 6.21830 |
| Vapour Pressure | 1.68E-11mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | VGAKUGNZBJXOFF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(-c2ccccc2)[nH]c(-c2ccccc2)c1-c1ccccc1 |
|
~89%
1-(2,4,5-triphe... CAS#:13901-75-2 |
| Literature: Tamaddon, Fatemeh; Farahi, Mahnaz; Karami, Bahador Journal of Molecular Catalysis A: Chemical, 2012 , vol. 356, p. 85 - 89 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |