5-ethyl-5-phenylbarbituric acid, compound with 1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one
Modify Date: 2025-09-14 12:03:34
5-ethyl-5-phenylbarbituric acid, compound with 1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one structure
|
Common Name | 5-ethyl-5-phenylbarbituric acid, compound with 1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 13900-05-5 | Molecular Weight | 420.46100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dimethyl-2-phenylpyrazol-3-one,5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H24N4O4 |
|---|---|
| Molecular Weight | 420.46100 |
| Exact Mass | 420.18000 |
| PSA | 109.18000 |
| LogP | 2.73660 |
| Vapour Pressure | 9.37E-13mmHg at 25°C |
| InChIKey | JQQIQZVQNHKNJI-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)NC1=O.Cc1cc(=O)n(-c2ccccc2)n1C |
| 1,5-dimethyl-2-phenyl-1,2-dihydro-3h-pyrazol-3-one-5-ethyl-5-phenylpyrimidine-2,4,6(1h,3h,5h)-trione(1:1) |
| EINECS 237-670-0 |
| 5-Ethyl-5-phenylbarbituric acid,compound with 1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one |