1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-cyclopropylcarbamate structure
|
Common Name | 1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-cyclopropylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 13887-61-1 | Molecular Weight | 279.28800 | |
| Density | 1.35g/cm3 | Boiling Point | 466.2ºC at 760 mmHg | |
| Molecular Formula | C14H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
| Name | [2-(2,3-dihydro-1,4-benzodioxin-3-yl)-2-hydroxyethyl] N-cyclopropylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 466.2ºC at 760 mmHg |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.28800 |
| Flash Point | 235.8ºC |
| Exact Mass | 279.11100 |
| PSA | 80.51000 |
| LogP | 1.28030 |
| Vapour Pressure | 1.71E-09mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | VCFPGQUWJMMYKA-UHFFFAOYSA-N |
| SMILES | O=C(NC1CC1)OCC(O)C1COc2ccccc2O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(1,4-Benzodiossan-2-il)-2-idrossietil-N-ciclopropil-1-carbammato |
| SAS 531 |
| Cyclopropanecarbamic acid,2-(1,4-benzodioxan-2-yl)-2-hydroxyethyl ester |
| 1,2-Ethanediol,1-(1,4-benzodioxan-2-yl)-,2-cyclopropylcarbamate |
| 2-(1,4-Benzodiossan-2-il)-2-idrossietil-N-ciclopropil-1-carbammato [Italian] |
| 2-(1,4-Benzodioxan-2-yl)-2-hydroxyethyl cyclopropanecarbamate |
| 2-(2-Cyclopropylcarbamoyloxy-1-hydroxyethyl)-1,4-benzodioxan |