1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-isopropylcarbamate structure
|
Common Name | 1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-isopropylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 13887-59-7 | Molecular Weight | 281.30400 | |
| Density | 1.222g/cm3 | Boiling Point | 441.5ºC at 760 mmHg | |
| Molecular Formula | C14H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.8ºC | |
| Name | [2-(2,3-dihydro-1,4-benzodioxin-3-yl)-2-hydroxyethyl] N-propan-2-ylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 441.5ºC at 760 mmHg |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.30400 |
| Flash Point | 220.8ºC |
| Exact Mass | 281.12600 |
| PSA | 80.51000 |
| LogP | 1.52630 |
| Vapour Pressure | 1.42E-08mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | HHPCQLLZYJQHJX-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)OCC(O)C1COc2ccccc2O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(1,4-Benzodioxan-2-yl)-2-hydroxyethyl isopropylcarbamate |
| 2-(1,4-Benzodiossan-2-il)-2-idrossietil-N-isopropil-1-carbammato [Italian] |
| SAS 506 |
| 2-(1-Hydroxy-2-isopropylcarbamoyloxy-ethyl)-1,4-benzodioxan |
| 1,2-Ethanediol,1-(1,4-benzodioxan-2-yl)-,isopropylcarbamate |
| Carbamic acid,isopropyl-,2-(1,4-benzodioxan-2-yl)-2-hydroxyethyl ester |