1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-isobutylcarbamate
Modify Date: 2025-10-26 18:36:30
1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-isobutylcarbamate structure
|
Common Name | 1-(1,4-Benzodioxan-2-yl)-1,2-ethanediol 2-isobutylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 13887-57-5 | Molecular Weight | 295.33100 | |
| Density | 1.197g/cm3 | Boiling Point | 452.1ºC at 760 mmHg | |
| Molecular Formula | C15H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.2ºC | |
| Name | [2-(2,3-dihydro-1,4-benzodioxin-3-yl)-2-hydroxyethyl] N-(2-methylpropyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 452.1ºC at 760 mmHg |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33100 |
| Flash Point | 227.2ºC |
| Exact Mass | 295.14200 |
| PSA | 80.51000 |
| LogP | 1.77390 |
| Vapour Pressure | 5.81E-09mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | LMWSHNLEYBZEOC-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(=O)OCC(O)C1COc2ccccc2O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Carbamic acid,isobutyl-,2-(1,4-benzodioxan-2-yl)-2-hydroxyethyl ester |
| SAS 529 |
| Isobutylcarbamic acid 2-(1,4-benzodioxan-2-yl)-2-hydroxyethyl ester |
| 1,2-Ethanediol,1-(1,4-benzodioxan-2-yl)-,isobutylcarbamate |
| 2-(1-Hydroxy-2-isobutylcarbamoyloxy-ethyl)-1,4-benzodioxan |
| 2-(1,4-Benzodiossan-2-il)-2-idrossietil-N-isobutil-1-carbammato [Italian] |