2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylindol-3-yl)pro panoic acid
Modify Date: 2025-08-26 11:51:09
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylindol-3-yl)pro panoic acid structure
|
Common Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylindol-3-yl)pro panoic acid | ||
|---|---|---|---|---|
| CAS Number | 138775-51-6 | Molecular Weight | 440.491 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 699.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 376.9±31.5 °C | |
| Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylindol-3-yl)pro panoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 699.7±55.0 °C at 760 mmHg |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.491 |
| Flash Point | 376.9±31.5 °C |
| Exact Mass | 440.173615 |
| PSA | 84.05000 |
| LogP | 5.73 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | GDPXIUSEXJJUGT-UHFFFAOYSA-N |
| SMILES | Cn1cc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~80%
2-(9H-fluoren-9... CAS#:138775-51-6 |
| Literature: Sircar, Jagadish C.; Khatuya, Haripada; Thomas, Richard J.; Alisala, Kashinatham; Vassar, Victor Charles; Nikoulin, Igor Patent: US2005/277690 A1, 2005 ; Location in patent: Page/Page column 24-25 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-methyltryptophan |
| Tryptophan, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-1-methyl- |
| 2-(Fmoc-amino)-3-(1-methyl-1H-indol-3-yl)-propanoic acid |
| 2-(fluoromethyl)-6-methyl-pyridine |