carboxyphosphoenolpyruvic acid
Modify Date: 2025-09-17 16:21:26
carboxyphosphoenolpyruvic acid structure
|
Common Name | carboxyphosphoenolpyruvic acid | ||
|---|---|---|---|---|
| CAS Number | 138668-74-3 | Molecular Weight | 212.05100 | |
| Density | 2.063g/cm3 | Boiling Point | 551.3ºC at 760 mmHg | |
| Molecular Formula | C4H5O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.2ºC | |
| Name | (E)-2-phosphonooxybut-2-enedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.063g/cm3 |
|---|---|
| Boiling Point | 551.3ºC at 760 mmHg |
| Molecular Formula | C4H5O8P |
| Molecular Weight | 212.05100 |
| Flash Point | 287.2ºC |
| Exact Mass | 211.97200 |
| PSA | 151.17000 |
| Vapour Pressure | 1.32E-13mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | KMNAUSZAPXSXLU-OWOJBTEDSA-N |
| SMILES | O=C(O)C=C(OP(=O)(O)O)C(=O)O |
|
~54%
carboxyphosphoe... CAS#:138668-74-3 |
| Literature: Journal of the American Chemical Society, , vol. 114, # 1 p. 377 - 378 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:144705-36-2| trisodium carboxyphosphonoenolpyruvate |
| Carboxyphosphoenolpyruvic acid |
| CPEPA |
| Trisodium carboxyphosphoenolpyruvate |