3-Chloro-6-methyl-2-nitroaniline structure
|
Common Name | 3-Chloro-6-methyl-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 13852-53-4 | Molecular Weight | 186.596 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 343.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.8±26.5 °C | |
| Name | 3-chloro-6-methyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.9±37.0 °C at 760 mmHg |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.596 |
| Flash Point | 161.8±26.5 °C |
| Exact Mass | 186.019608 |
| PSA | 71.84000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | DKUCSJAKXOTDCM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c([N+](=O)[O-])c1N |
| HS Code | 2921430090 |
|---|
|
~%
3-Chloro-6-meth... CAS#:13852-53-4 |
| Literature: Kenner; Tod; Witham Journal of the Chemical Society, 1925 , vol. 127, p. 2348 |
|
~%
3-Chloro-6-meth... CAS#:13852-53-4 |
| Literature: Godfrey,K.E.; Thrift,R.I. Journal of the Chemical Society [Section] C: Organic, 1967 , p. 400 - 404 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Chlor-6-methyl-2-nitro-anilin |
| 3-Chloro-6-methyl-2-nitroaniline |
| Benzenamine, 3-chloro-6-methyl-2-nitro- |
| 4-Chlor-3-nitro-2-amino-toluol |
| 3-chloro-6-methyl-2-nitro-aniline |
| 5-Chlor-6-nitro-2-methyl-anilin |