Benzoicacid, 2-(4,6-dichloro-1,3,5-triazin-2-yl)hydrazide
Modify Date: 2025-09-19 20:33:35
Benzoicacid, 2-(4,6-dichloro-1,3,5-triazin-2-yl)hydrazide structure
|
Common Name | Benzoicacid, 2-(4,6-dichloro-1,3,5-triazin-2-yl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 13838-36-3 | Molecular Weight | 284.10100 | |
| Density | 1.572g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7Cl2N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(4,6-dichloro-1,3,5-triazin-2-yl)benzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.572g/cm3 |
|---|---|
| Molecular Formula | C10H7Cl2N5O |
| Molecular Weight | 284.10100 |
| Exact Mass | 283.00300 |
| PSA | 83.03000 |
| LogP | 1.74810 |
| Index of Refraction | 1.682 |
| InChIKey | OTPALJUANAQYRF-UHFFFAOYSA-N |
| SMILES | O=C(NNc1nc(Cl)nc(Cl)n1)c1ccccc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2,4-Dichlor-6-benzoylhydrazino-1,3,5-triazin |