tert-butyl N-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamate structure
|
Common Name | tert-butyl N-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 138356-92-0 | Molecular Weight | 242.31500 | |
| Density | 1.088g/cm3 | Boiling Point | 386.916ºC at 760 mmHg | |
| Molecular Formula | C12H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | tert-butyl N-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 386.916ºC at 760 mmHg |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.31500 |
| Flash Point | 187.8ºC |
| Exact Mass | 242.16300 |
| PSA | 58.64000 |
| LogP | 1.85080 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | LYZNPJJKVMGOQL-VIFPVBQESA-N |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)N1CCCC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Boc-L-alanine-pyrrolidine amide |