4-[4-[4-[4-amino-2-(trifluoromethyl)phenoxy]phenyl]phenoxy]-3-(trifluoromethyl)aniline structure
|
Common Name | 4-[4-[4-[4-amino-2-(trifluoromethyl)phenoxy]phenyl]phenoxy]-3-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 138321-99-0 | Molecular Weight | 504.424 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 554.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C26H18F6N2O2 | Melting Point | 155-156ºC | |
| MSDS | N/A | Flash Point | 289.3±30.1 °C | |
| Name | 4-[4-[4-[4-amino-2-(trifluoromethyl)phenoxy]phenyl]phenoxy]-3-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 554.8±50.0 °C at 760 mmHg |
| Melting Point | 155-156ºC |
| Molecular Formula | C26H18F6N2O2 |
| Molecular Weight | 504.424 |
| Flash Point | 289.3±30.1 °C |
| Exact Mass | 504.127258 |
| PSA | 70.50000 |
| LogP | 7.49 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | IWFSADBGACLBMH-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(-c3ccc(Oc4ccc(N)cc4C(F)(F)F)cc3)cc2)c(C(F)(F)F)c1 |
|
~82%
4-[4-[4-[4-amin... CAS#:138321-99-0 |
| Literature: Zhang, Qingshuang; Li, Qiaoling Chinese Journal of Chemistry, 2011 , vol. 29, # 7 p. 1460 - 1466 |
|
~%
4-[4-[4-[4-amin... CAS#:138321-99-0 |
| Literature: Chinese Journal of Chemistry, , vol. 29, # 7 p. 1460 - 1466 |
|
~%
4-[4-[4-[4-amin... CAS#:138321-99-0 |
| Literature: Chinese Journal of Chemistry, , vol. 29, # 7 p. 1460 - 1466 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenamine, 4,4'-[[1,1'-biphenyl]-4,4'-diylbis(oxy)]bis[3-(trifluoromethyl)- |
| 4,4'-[Biphenyl-4,4'-diylbis(oxy)]bis[3-(trifluoromethyl)aniline] |
| 4,4'-bis(4-amino-2-trifluoromethylphenoxy)biphenyl |
| 4,4'-[4,4'-Biphenyldiylbis(oxy)]bis[3-(trifluoromethyl)aniline] |