diethyl 2-(1,3-dibromopropan-2-ylidene)propanedioate
Modify Date: 2025-09-23 10:31:14
diethyl 2-(1,3-dibromopropan-2-ylidene)propanedioate structure
|
Common Name | diethyl 2-(1,3-dibromopropan-2-ylidene)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 13830-94-9 | Molecular Weight | 358.02400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-(1,3-dibromopropan-2-ylidene)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14Br2O4 |
|---|---|
| Molecular Weight | 358.02400 |
| Exact Mass | 355.92600 |
| PSA | 52.60000 |
| LogP | 2.19900 |
| InChIKey | DEQYVBBWVJBWPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)=C(CBr)CBr |
|
~%
diethyl 2-(1,3-... CAS#:13830-94-9 |
| Literature: Ehrlich,K.; Emerson,G.F. Journal of the American Chemical Society, 1972 , vol. 94, # 7 p. 2464 - 2470 |
|
~14%
diethyl 2-(1,3-... CAS#:13830-94-9 |
| Literature: Togo, Hideo; Hirai, Takeshi Synlett, 2003 , # 5 p. 702 - 704 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3-Dibromisopropyliden-malonsaeure-diethylester |
| 1,1-Dicarbethoxy-2-brommethylallylbromid |
| Propanedioic acid,[2-bromo-1-(bromomethyl)ethylidene]-,diethyl ester |