1-Methyl-2-phenyl-1, 2-dihydro-pyridazine-3, 6-dione structure
|
Common Name | 1-Methyl-2-phenyl-1, 2-dihydro-pyridazine-3, 6-dione | ||
|---|---|---|---|---|
| CAS Number | 13817-74-8 | Molecular Weight | 202.20900 | |
| Density | 1.271g/cm3 | Boiling Point | 317.2ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.2ºC | |
| Name | 1-methyl-2-phenylpyridazine-3,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 317.2ºC at 760 mmHg |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Flash Point | 139.2ºC |
| Exact Mass | 202.07400 |
| PSA | 44.00000 |
| LogP | 0.53620 |
| Vapour Pressure | 0.000392mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | HJHFNYLISJKDGC-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)ccc(=O)n1-c1ccccc1 |
|
~%
1-Methyl-2-phen... CAS#:13817-74-8 |
| Literature: Eichenberger et al. Helvetica Chimica Acta, 1954 , vol. 37, p. 837,848 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-methyl-2-phenyl-1,2-dihydro-pyridazine-3,6-dione |
| 1-Methyl-2-phenyl-1,2-dihydro-pyridazin-3,6-dion |
| 2-methyl-1-phenyl-1,2-dihydro-3,6-pyridazinedione |
| 3,6-Dioxo-2-methyl-1-phenyl-1.2.3.6-tetrahydro-pyridazin |
| 1-Phenyl-2-methyl-1,2,3,6-tetrahydro-3,6-pyridazindion |
| 1-Methyl-2-phenyl-3,6-pyridazinedione |