ethyl 4-chloro-5-formyl-3-methyl-6,7-dihydro-1-benzofuran-2-carboxylate structure
|
Common Name | ethyl 4-chloro-5-formyl-3-methyl-6,7-dihydro-1-benzofuran-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 137987-76-9 | Molecular Weight | 268.69300 | |
| Density | 1.31g/cm3 | Boiling Point | 418.8ºC at 760 mmHg | |
| Molecular Formula | C13H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.1ºC | |
| Name | ethyl 4-chloro-5-formyl-3-methyl-6,7-dihydro-1-benzofuran-2-carboxylate |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 418.8ºC at 760 mmHg |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.69300 |
| Flash Point | 207.1ºC |
| Exact Mass | 268.05000 |
| PSA | 56.51000 |
| LogP | 2.85970 |
| Vapour Pressure | 3.19E-07mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | GECMCNWALPGVMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1oc2c(c1C)C(Cl)=C(C=O)CC2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |