6-(3-fluorophenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione structure
|
Common Name | 6-(3-fluorophenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 137897-68-8 | Molecular Weight | 326.34300 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H15FN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(3-fluorophenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C14H15FN2O4S |
| Molecular Weight | 326.34300 |
| Exact Mass | 326.07400 |
| PSA | 109.88000 |
| LogP | 1.51400 |
| Index of Refraction | 1.629 |
| InChIKey | DROKKNCXSIVRJW-UHFFFAOYSA-N |
| SMILES | Cc1c(Sc2cccc(F)c2)n(COCCO)c(=O)[nH]c1=O |
|
~%
6-(3-fluorophen... CAS#:137897-68-8 |
| Literature: Tanaka, Hiromichi; Takashima, Hideaki; Ubasawa, Masaru; Sekiya, Kouichi; Nitta, Iasei; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 2 p. 337 - 345 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3'-FHEPT |
| 6-<(3-fluorophenyl)thio>-1-<(2-hydroxyethoxy)methyl>thymine |