[(2S,5R)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol
Modify Date: 2024-02-01 13:05:24
![[(2S,5R)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol Structure](https://image.chemsrc.com/caspic/260/137719-31-4.png)
[(2S,5R)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol structure
|
Common Name | [(2S,5R)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 137719-31-4 | Molecular Weight | 266.32300 | |
| Density | 1.92g/cm3 | Boiling Point | 677.3ºC at 760mmHg | |
| Molecular Formula | C10H14N6OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.4ºC | |
| Name | [(2S,5R)-5-(2,6-diaminopurin-9-yl)thiolan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.92g/cm3 |
|---|---|
| Boiling Point | 677.3ºC at 760mmHg |
| Molecular Formula | C10H14N6OS |
| Molecular Weight | 266.32300 |
| Flash Point | 363.4ºC |
| Exact Mass | 266.09500 |
| PSA | 141.90000 |
| LogP | 0.88850 |
| Vapour Pressure | 2.86E-19mmHg at 25°C |
| Index of Refraction | 1.944 |
| InChIKey | XCBQEWWAIKYUCJ-NTSWFWBYSA-N |
| SMILES | Nc1nc(N)c2ncn(C3CCC(CO)S3)c2n1 |
|
~%
[(2S,5R)-5-(2,6... CAS#:137719-31-4 |
| Literature: Secrist, John A.; Riggs, Robert M.; Tiwari, Kamal N.; Montgomery, John A. Journal of Medicinal Chemistry, 1992 , vol. 35, # 3 p. 533 - 538 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![2-amino-9-[(2R,5S)-5-(hydroxymethyl)thiolan-2-yl]-3H-purin-6-one structure](https://image.chemsrc.com/caspic/222/137719-32-5.png)
CAS#:137719-32-5| 2-amino-2',3'-dideoxy-4'-thioadenosine |