MC-DM1
Modify Date: 2025-08-25 21:58:50
MC-DM1 structure
|
Common Name | MC-DM1 | ||
|---|---|---|---|---|
| CAS Number | 1375089-56-7 | Molecular Weight | 843.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H55ClN4O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-DM1MC-DM1 is a drug-linker conjugate composed of a potent microtubule-disrupting agent DM1 and a linker MC to make antibody drug conjugate (ADC)[1]. |
| Name | MC-DM1 |
|---|
| Description | MC-DM1 is a drug-linker conjugate composed of a potent microtubule-disrupting agent DM1 and a linker MC to make antibody drug conjugate (ADC)[1]. |
|---|---|
| Related Catalog | |
| Target |
Maytansinoids |
| References |
| Molecular Formula | C42H55ClN4O12 |
|---|---|
| Molecular Weight | 843.36 |
| InChIKey | UGBPANNIQRLRII-MYFUOFFMSA-N |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC(OC(=O)C(C)N(C)C(=O)CCCCCN1C(=O)C=CC1=O)C1(C)OC1C(C)C1CC(O)(NC(=O)O1)C(OC)C=CC=C(C)C2 |