2-Methyl-2-propanyl [(1R)-2-oxo-1-phenylethyl]carbamate structure
|
Common Name | 2-Methyl-2-propanyl [(1R)-2-oxo-1-phenylethyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 137284-11-8 | Molecular Weight | 235.279 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 356.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5±25.9 °C | |
| Name | 2-Methyl-2-propanyl [(1R)-2-oxo-1-phenylethyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.7±35.0 °C at 760 mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.279 |
| Flash Point | 169.5±25.9 °C |
| Exact Mass | 235.120850 |
| PSA | 58.89000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | PEVGKAAGTGDOGA-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NC(C=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid,N-[(1R)-1-(4-bromophenyl)ethyl]-,1,1-dimethylethyl ester |
| (R)-N-(1,1-dimethylethoxycarbonyl)-2,4,5-trifluorophenylalanine methyl ester |
| (R)-N-(tert-butoxycarbonyl)-2-phenylglycinal |
| (R)-methyl 2-((tert-butoxycarbonyl)amino)-3-(2,4,5-trifluorophenyl)propanoate |
| (R)-N-(tert-butoxycarbonyl)-2,4,5-trifluorophenylalanine methyl ester |
| tert-Butyl [(1R)-1-(4-bromophenyl)ethyl]carbamate |
| (R)-N-(tert-butoxycarbonyl)-1-(4-bromophenyl)ethylamine |
| Carbamicacid,[(1R)-1-(4-bromophenyl)ethyl]-,1,1-dimethylethyl ester (9CI) |
| [(R)-1-(4-bromo-phenyl)-ethyl]-carbamic acid tert-butyl ester |
| N-Boc-D-phenylglycinal |
| (2R)-2-N-(tert-butoxycarbonyl)amino-2-phenylethanal |
| 2-Methyl-2-propanyl [(1R)-2-oxo-1-phenylethyl]carbamate |
| (R)-(N-t-butoxycarbonyl)-2-phenylglycinal |
| Carbamic acid, N-[(1R)-2-oxo-1-phenylethyl]-, 1,1-dimethylethyl ester |
| tert-butyl [(1R)-2-oxo-1-phenylethyl]carbamate |
| (R)-tert-butyl 1-(4-Bromophenyl)ethylcarbamate |