1-amino-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid structure
|
Common Name | 1-amino-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 13725-03-6 | Molecular Weight | 199.29000 | |
| Density | 0.988g/cm3 | Boiling Point | 289ºC at 760 mmHg | |
| Molecular Formula | C11H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.6ºC | |
| Name | 1-amino-3,3,5,5-tetramethylcyclohexane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.988g/cm3 |
|---|---|
| Boiling Point | 289ºC at 760 mmHg |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29000 |
| Flash Point | 128.6ºC |
| Exact Mass | 199.15700 |
| PSA | 63.32000 |
| LogP | 2.70510 |
| Vapour Pressure | 0.000569mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | QCURZCYGNMLPQB-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(C)CC(N)(C(=O)O)C1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Cyclohexanecarboxylicacid,1-amino-3,3,5,5-tetramethyl |
| 1-Amino-3,3,5,5-tetramethylcyclohexancarbonsaeure |
| 1-Amino-3,3,5,5-tetramethylcyclohexanecarboxylicacid |