2-(4-amino-3-butoxybenzoyl)oxyethyl-diethylazanium,chloride
Modify Date: 2025-10-13 20:26:46
2-(4-amino-3-butoxybenzoyl)oxyethyl-diethylazanium,chloride structure
|
Common Name | 2-(4-amino-3-butoxybenzoyl)oxyethyl-diethylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 13718-13-3 | Molecular Weight | 344.87700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H29ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-amino-3-butoxybenzoyl)oxyethyl-diethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H29ClN2O3 |
|---|---|
| Molecular Weight | 344.87700 |
| Exact Mass | 344.18700 |
| PSA | 64.79000 |
| LogP | 4.32950 |
| InChIKey | PRGUDWLMFLCODA-UHFFFAOYSA-N |
| SMILES | CCCCOc1cc(C(=O)OCC[NH+](CC)CC)ccc1N.[Cl-] |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Opulets Benoxinate |
| Minims Benoxinate |
| Conjuncain |
| Benoxinate HCL |
| Novesine |
| Novesina |
| Oxbarukain |
| Novesin |
| Cebesine |
| Lacrimin |