N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide
Modify Date: 2025-09-09 15:49:23
N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide structure
|
Common Name | N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 1370600-70-6 | Molecular Weight | 200.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H20N2O2 |
|---|---|
| Molecular Weight | 200.28 |
| InChIKey | ZZJVGYWAJFXOLY-UHFFFAOYSA-N |
| SMILES | CC(NNC(=O)OC(C)(C)C)C1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide? |
| A: SMILES notation of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide is CC(NNC(=O)OC(C)(C)C)C1CC1. |
| Q: What is the CAS number of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide? |
| A: CAS number of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide is 1370600-70-6. |
| Q: What is the InChIKey of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide? |
| A: InChIKey of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide is ZZJVGYWAJFXOLY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide? |
| A: Molecular formula of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide is C10H20N2O2. |
| Q: What is the Chinese name of 1370600-70-6? |
| A: Chinese name of 1370600-70-6 is 1370600-70-6. |
| Q: What is the molecular weight of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide? |
| A: Molecular weight of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide is 200.28. |
| Q: What is the English name of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide? |
| A: The English name of N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide is N'-(1-cyclopropylethyl)(tert-butoxy)carbohydrazide. |