litebamine structure
|
Common Name | litebamine | ||
|---|---|---|---|---|
| CAS Number | 137031-56-2 | Molecular Weight | 339.38500 | |
| Density | 1.303g/cm3 | Boiling Point | 565ºC at 760mmHg | |
| Molecular Formula | C20H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.5ºC | |
| Name | 9,11-dimethoxy-2-methyl-3,4-dihydro-1H-naphtho[2,1-f]isoquinoline-8,12-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 565ºC at 760mmHg |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.38500 |
| Flash Point | 295.5ºC |
| Exact Mass | 339.14700 |
| PSA | 62.16000 |
| LogP | 3.34720 |
| Vapour Pressure | 2.27E-13mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | QOWFEPGZJDCIKG-UHFFFAOYSA-N |
| SMILES | COc1cc2c(ccc3c4c(c(O)c(OC)c32)CN(C)CC4)cc1O |
|
~%
litebamine CAS#:137031-56-2 |
| Literature: Journal of Natural Products, , vol. 61, # 1 p. 46 - 50 |
| Litebamine |