Okicenone
Modify Date: 2025-08-25 10:02:29
Okicenone structure
|
Common Name | Okicenone | ||
|---|---|---|---|---|
| CAS Number | 137018-54-3 | Molecular Weight | 258.26900 | |
| Density | 1.459g/cm3 | Boiling Point | 549.8ºC at 760mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.4ºC | |
Use of OkicenoneOkicenone is a Hu protein R (HuR) inhibitor. Okicenone inhibits HuR oligomerization, interferes with HuR RNA binding, HuR trafficking, cytokine expression and T-cell activation[1]. |
| Name | 4,6,9-trihydroxy-8-methyl-3,4-dihydro-2H-anthracen-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Okicenone is a Hu protein R (HuR) inhibitor. Okicenone inhibits HuR oligomerization, interferes with HuR RNA binding, HuR trafficking, cytokine expression and T-cell activation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 549.8ºC at 760mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.26900 |
| Flash Point | 300.4ºC |
| Exact Mass | 258.08900 |
| PSA | 77.76000 |
| LogP | 2.56930 |
| Vapour Pressure | 6.38E-13mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | LIETVYHJBSLSSW-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc2cc3c(c(O)c12)C(=O)CCC3O |
| Okicenone |
| 1(2H)-Anthracenone,3,4-dihydro-4,6,9-trihydroxy-8-methyl |
| 3,4-Dihydro-4,6,9-trihydroxy-8-methyl-1(2H)-anthracenone |