4-Bromo-4’-methoxydiphenylamine structure
|
Common Name | 4-Bromo-4’-methoxydiphenylamine | ||
|---|---|---|---|---|
| CAS Number | 13677-42-4 | Molecular Weight | 278.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Bromo-4’-methoxydiphenylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12BrNO |
|---|---|
| Molecular Weight | 278.14400 |
| Exact Mass | 277.01000 |
| PSA | 21.26000 |
| LogP | 4.27430 |
| InChIKey | FXJJSRXECRBIPV-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(Br)cc2)cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Brom-4'-methoxy-diphenylamin |