4-Hydroxy-6-methoxyquinoline-3-carbonitrile structure
|
Common Name | 4-Hydroxy-6-methoxyquinoline-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 13669-61-9 | Molecular Weight | 200.19300 | |
| Density | 1.32g/cm3 | Boiling Point | 356ºC at 760mmHg | |
| Molecular Formula | C11H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | 6-methoxy-4-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 356ºC at 760mmHg |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.19300 |
| Flash Point | 169.1ºC |
| Exact Mass | 200.05900 |
| PSA | 66.14000 |
| LogP | 1.82068 |
| Vapour Pressure | 3.01E-05mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | OTDUOKQHVNMOLT-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]cc(C#N)c(=O)c2c1 |
| HS Code | 2933499090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-hydroxy-6-(methyloxy)-3-quinolinecarbonitrile |
| 4-HYDROXY-6-METHOXYQUINOLINE-3-CARBONITRILE |
| 4-Hydroxy-6-methoxy-3-cyanchinolin |
| 3-Quinolinecarbonitrile,4-hydroxy-6-methoxy |
| 3-Cyan-4-hydroxy-6-methoxychinolin |