4-(Difluoromethyl)benzyl pivalate
Modify Date: 2025-09-18 19:44:45
4-(Difluoromethyl)benzyl pivalate structure
|
Common Name | 4-(Difluoromethyl)benzyl pivalate | ||
|---|---|---|---|---|
| CAS Number | 1366392-25-7 | Molecular Weight | 242.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(Difluoromethyl)benzyl pivalate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16F2O2 |
|---|---|
| Molecular Weight | 242.26200 |
| Exact Mass | 242.11200 |
| PSA | 26.30000 |
| LogP | 3.71350 |
| InChIKey | WUWGJBOUYXUILS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCc1ccc(C(F)F)cc1 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| BENZENE,4-(DIFLUOROMETHOXY)-2-METHYL-1-NITRO |
| 5-(Difluoromethoxy)-2-nitro-toluene |