3-(4-Chlorophenyl)-1,2,4-triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline
Modify Date: 2025-08-25 17:48:18
3-(4-Chlorophenyl)-1,2,4-triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline structure
|
Common Name | 3-(4-Chlorophenyl)-1,2,4-triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline | ||
|---|---|---|---|---|
| CAS Number | 136633-12-0 | Molecular Weight | 363.82400 | |
| Density | 1.56g/cm3 | Boiling Point | 699.9ºC at 760 mmHg | |
| Molecular Formula | C18H10ClN5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 377.1ºC | |
| Name | 3-(4-Chlorophenyl)-1,2,4-triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 699.9ºC at 760 mmHg |
| Molecular Formula | C18H10ClN5S |
| Molecular Weight | 363.82400 |
| Flash Point | 377.1ºC |
| Exact Mass | 363.03500 |
| PSA | 81.26000 |
| LogP | 3.92910 |
| Vapour Pressure | 1.96E-19mmHg at 25°C |
| Index of Refraction | 1.818 |
| InChIKey | QALAKHXWSGYCOM-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2nnc3n2N=Cc2cc4ccccc4nc2S3)cc1 |
|
~95%
3-(4-Chlorophen... CAS#:136633-12-0 |
| Literature: Prabhuswamy; Ambekar, Sarvottam Y. Synthetic Communications, 1999 , vol. 29, # 20 p. 3487 - 3497 |
|
~%
3-(4-Chlorophen... CAS#:136633-12-0 |
| Literature: Kalluraya, Balakrishna; Gururaja; Rai, Ganesha Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 1 p. 211 - 214 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(4'-chlorophenyl)-(1:2:4)-triazolo-[3,4-b](1,3,4)thiadiazepino(6,7-3,2)quinoline |
| 1,2,4-Triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline,3-(4-chlorophenyl) |