5-(4-chlorophenoxy)-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane
Modify Date: 2025-09-24 18:24:41
![5-(4-chlorophenoxy)-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane Structure](https://image.chemsrc.com/caspic/074/13644-11-6.png)
5-(4-chlorophenoxy)-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane structure
|
Common Name | 5-(4-chlorophenoxy)-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane | ||
|---|---|---|---|---|
| CAS Number | 13644-11-6 | Molecular Weight | 301.79800 | |
| Density | 1.31g/cm3 | Boiling Point | 347.5ºC at 760 mmHg | |
| Molecular Formula | C12H16ClNO4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164ºC | |
| Name | 5-(4-chlorophenoxy)-4,6,11-trioxa-1-aza-5-silabicyclo[3.3.3]undecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 347.5ºC at 760 mmHg |
| Molecular Formula | C12H16ClNO4Si |
| Molecular Weight | 301.79800 |
| Flash Point | 164ºC |
| Exact Mass | 301.05400 |
| PSA | 40.16000 |
| LogP | 1.47130 |
| Vapour Pressure | 5.36E-05mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | JARJVNNXANWDAQ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(O[Si]23OCCN(CCO2)CCO3)cc1 |
|
~%
5-(4-chlorophen... CAS#:13644-11-6 |
| Literature: Voronkov,M.G.; Zelchan,G.I. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1969 , vol. 5, # 1 p. 34 - 38 Khimiya Geterotsiklicheskikh Soedinenii, 1969 , vol. 5, # 1 p. 43 - 48 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-(p-Chlorophenoxy)silatrane |
| 1-<4-Chlor-phenoxy>-silatran |
| Silicic acid,(H4SiO4),p-chlorophenyl ester,cyclic ester with 2,2',2''-nitrilotriethanol |
| 1-p-Chlorphenyloxysilatren |
| 1-(4-chlorophenoxy)silatrane |
| p-Chlorophenoxysilatrane |
| 1-p-Chlorpenoxy-silatrane |
| p-Chlorfenoxysilatran [Czech] |
| 1-(p-Chlorophenoxy)-2,8,9-trioxa-5-aza-1-silabicyclo(3.3.3)undecane |
| 1-(4-Chlor-phenyloxy)-silatran |
| 2,8,9-Trioxa-5-aza-1-silabicyclo(3.3.3)undecane,1-(p-chlorophenoxy) |
| p-Chlorfenoxysilatran |