4-(piperidin-1-ylmethyl)-1H-quinolin-2-one
Modify Date: 2025-11-30 11:56:43
4-(piperidin-1-ylmethyl)-1H-quinolin-2-one structure
|
Common Name | 4-(piperidin-1-ylmethyl)-1H-quinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 13629-28-2 | Molecular Weight | 242.31600 | |
| Density | 1.147g/cm3 | Boiling Point | 428.6ºC at 760 mmHg | |
| Molecular Formula | C15H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | 4-(piperidin-1-ylmethyl)-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 428.6ºC at 760 mmHg |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.31600 |
| Flash Point | 213ºC |
| Exact Mass | 242.14200 |
| PSA | 36.10000 |
| LogP | 2.45190 |
| Vapour Pressure | 1.5E-07mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | GECKEQUEMQXTCF-UHFFFAOYSA-N |
| SMILES | O=c1cc(CN2CCCCC2)c2ccccc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Piperidin-1-ylmethyl-1H-quinolin-2-one |
| A-2587 |
| 4-Piperidinomethylcarbostyril |