1,5-dimethyl-6-phenylsulfanylpyrimidine-2,4-dione structure
|
Common Name | 1,5-dimethyl-6-phenylsulfanylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 136160-19-5 | Molecular Weight | 248.30100 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dimethyl-6-phenylsulfanylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.30100 |
| Exact Mass | 248.06200 |
| PSA | 80.42000 |
| LogP | 1.94550 |
| Index of Refraction | 1.651 |
| InChIKey | HEAFEFDUVJFUPX-UHFFFAOYSA-N |
| SMILES | Cc1c(Sc2ccccc2)n(C)c(=O)[nH]c1=O |
|
~51%
1,5-dimethyl-6-... CAS#:136160-19-5 |
| Literature: Mitsubishi Kasei Corporation Patent: US5461060 A1, 1995 ; |
|
~13%
1,5-dimethyl-6-... CAS#:136160-19-5 |
| Literature: Tanaka, Hiromichi; Takashima, Hideaki; Ubasawa, Masaru; Sekiya, Kouichi; Nitta, Issei; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 25 p. 4713 - 4719 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Me6PhS T |
| 1-methyl-6-phenylthiothymine |