3-chloro-2-oxopropyl triphenylphosphonium chloride
Modify Date: 2025-09-01 17:02:08
3-chloro-2-oxopropyl triphenylphosphonium chloride structure
|
Common Name | 3-chloro-2-oxopropyl triphenylphosphonium chloride | ||
|---|---|---|---|---|
| CAS Number | 13605-65-7 | Molecular Weight | 389.25500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19Cl2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-2-oxopropyl triphenylphosphonium chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H19Cl2OP |
|---|---|
| Molecular Weight | 389.25500 |
| Exact Mass | 388.05500 |
| PSA | 30.66000 |
| LogP | 0.79240 |
| InChIKey | HLQOHQLJKMAQPH-UHFFFAOYSA-M |
| SMILES | O=C(CCl)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| chlorure de chloroacetonyltriphenylphosphonium |
| 3-chloroacetonyltriphenylphosphonium chloride |
| chloroacetylmethyl triphenylphosphonium chloride |