AZD-3463 structure
|
Common Name | AZD-3463 | ||
|---|---|---|---|---|
| CAS Number | 1356962-20-3 | Molecular Weight | 448.948 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 723.6±70.0 °C at 760 mmHg | |
| Molecular Formula | C24H25ClN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.4±35.7 °C | |
Use of AZD-3463AZD-3463 is an ALK/IGF1R inhibitor which overcomes multiple mechanisms of acquired resistance to crizotinib.IC50 Value:Target: ALK/IGF1R |
| Name | N-[4-(4-aminopiperidin-1-yl)-2-methoxyphenyl]-5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Description | AZD-3463 is an ALK/IGF1R inhibitor which overcomes multiple mechanisms of acquired resistance to crizotinib.IC50 Value:Target: ALK/IGF1R |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 723.6±70.0 °C at 760 mmHg |
| Molecular Formula | C24H25ClN6O |
| Molecular Weight | 448.948 |
| Flash Point | 391.4±35.7 °C |
| Exact Mass | 448.177826 |
| PSA | 92.09000 |
| LogP | 3.11 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | GCYIGMXOIWJGBU-UHFFFAOYSA-N |
| SMILES | COc1cc(N2CCC(N)CC2)ccc1Nc1ncc(Cl)c(-c2c[nH]c3ccccc23)n1 |
| Storage condition | -20℃ |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ALK/IGF1R inhibitor||AZD3463|AZD 3463 |
| N-[4-(4-Amino-1-piperidinyl)-2-methoxyphenyl]-5-chloro-4-(1H-indol-3-yl)-2-pyrimidinamine |
| AZD3463 |
| 2-Pyrimidinamine, N-[4-(4-amino-1-piperidinyl)-2-methoxyphenyl]-5-chloro-4-(1H-indol-3-yl)- |
| ALK/IGF1R inhibitor |
| S7106 |
| N-(4-(4-aminopiperidin-1-yl)-2-methoxyphenyl)-5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine |
| CS-1382 |
| AZD-3463 |