1-(2,3-Difluoro-4-methoxyphenyl)-2,2,2-trifluoroethanone
Modify Date: 2025-10-11 16:25:31
1-(2,3-Difluoro-4-methoxyphenyl)-2,2,2-trifluoroethanone structure
|
Common Name | 1-(2,3-Difluoro-4-methoxyphenyl)-2,2,2-trifluoroethanone | ||
|---|---|---|---|---|
| CAS Number | 1356109-99-3 | Molecular Weight | 240.12700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,3-Difluoro-4-methoxyphenyl)-2,2,2-trifluoroethanone |
|---|
| Molecular Formula | C9H5F5O2 |
|---|---|
| Molecular Weight | 240.12700 |
| Exact Mass | 240.02100 |
| PSA | 26.30000 |
| LogP | 2.71840 |
| InChIKey | QGCQULMTLOLTNY-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(F)(F)F)c(F)c1F |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |