ethyl 2-[(2-acetamido-3-phenyl-propanoyl)amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate
Modify Date: 2025-09-26 22:58:51
![ethyl 2-[(2-acetamido-3-phenyl-propanoyl)amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate Structure](https://image.chemsrc.com/caspic/204/13555-25-4.png)
ethyl 2-[(2-acetamido-3-phenyl-propanoyl)amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate structure
|
Common Name | ethyl 2-[(2-acetamido-3-phenyl-propanoyl)amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 13555-25-4 | Molecular Weight | 522.46400 | |
| Density | 1.229g/cm3 | Boiling Point | 753ºC at 760 mmHg | |
| Molecular Formula | C26H33Cl2N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 409.2ºC | |
| Name | 1-(2-ethoxyethoxy)-3-methylbutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 753ºC at 760 mmHg |
| Molecular Formula | C26H33Cl2N3O4 |
| Molecular Weight | 522.46400 |
| Flash Point | 409.2ºC |
| Exact Mass | 521.18500 |
| PSA | 87.74000 |
| LogP | 4.09020 |
| Vapour Pressure | 1.47E-22mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | DGOPINOGGYUGAU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)C(Cc1ccccc1)NC(C)=O |
|
~%
ethyl 2-[(2-ace... CAS#:13555-25-4 |
| Literature: Bergel,F.; Stock,J.A. Journal of the Chemical Society, 1960 , p. 3658 - 3669 |
![4-[bis-(2-chloro-ethyl)-amino]-DL-phenylalanine ethyl ester, monohydrochloride structure](https://image.chemsrc.com/caspic/228/112117-81-4.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ac-L-Phe-Mel-OEt |
| N-Acetyl-L-phenylalanyl-melphalan-ethylester |
| Acetaldehyde ethyl 3-methylbutyl acetal |