3-(1,3-benzothiazol-2-ylmethylamino)-5-ethyl-6-methyl-1H-pyridin-2-one structure
|
Common Name | 3-(1,3-benzothiazol-2-ylmethylamino)-5-ethyl-6-methyl-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 135525-68-7 | Molecular Weight | 299.39100 | |
| Density | N/A | Boiling Point | 534.4ºC at 760 mmHg | |
| Molecular Formula | C16H17N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277ºC | |
| Name | 3-(1,3-benzothiazol-2-ylmethylamino)-5-ethyl-6-methyl-1H-pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 534.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.39100 |
| Flash Point | 277ºC |
| Exact Mass | 299.10900 |
| PSA | 86.28000 |
| LogP | 3.95280 |
| Vapour Pressure | 1.7E-11mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | YYFIAMJITQWHCZ-UHFFFAOYSA-N |
| SMILES | CCc1cc(NCc2nc3ccccc3s2)c(=O)[nH]c1C |
|
~%
3-(1,3-benzothi... CAS#:135525-68-7 |
| Literature: Saari, Walfred S.; Wai, John S.; Fisher, Thorsten E.; Thomas, Craig M.; Hoffman, Jacob M.; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 21 p. 3792 - 3802 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-((2-Benzothiazolylmethyl)amino)-5-ethyl-6-methylpyridin-2(1H)-one |
| 3-[(2-Benzothiazolylmethyl)amino]-5-ethyl-6-methyl-2-(1H)-pyridinone |
| 3-Aminopyridin-2(1H)-one analogue 7 |