Desmethyl-WEHI-345 analog
Modify Date: 2025-08-27 18:09:47
Desmethyl-WEHI-345 analog structure
|
Common Name | Desmethyl-WEHI-345 analog | ||
|---|---|---|---|---|
| CAS Number | 1354825-03-8 | Molecular Weight | 401.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Desmethyl-WEHI-345 analogDesmethyl-WEHI-345 analog is a protein kinase inhibitor extracted from patent WO2012003544A1, example 12. Desmethyl-WEHI-345 analog can be used for the research of colon cancer[1]. |
| Name | Desmethyl-WEHI-345 analog |
|---|
| Description | Desmethyl-WEHI-345 analog is a protein kinase inhibitor extracted from patent WO2012003544A1, example 12. Desmethyl-WEHI-345 analog can be used for the research of colon cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
protein kinase[1] |
| In Vitro | Desmethyl-WEHI-345 analog inhibits cells growth of LIM 1215, LIM2537, RasNIH3T3 and LIM 1899 cells[1]. |
| References |
[1]. Baell JB, et, al. Protein kinase inhibitors and methods of treatment. WO2012003544A1. |
| Molecular Formula | C22H23N7O |
|---|---|
| Molecular Weight | 401.46 |
| InChIKey | LWMDASJLUKFLSE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nn(C(C)(C)CNC(=O)c3ccccn3)c3ncnc(N)c23)cc1 |