2-(benzylsulfonyl)benzoic acid
Modify Date: 2024-01-16 11:14:47
2-(benzylsulfonyl)benzoic acid structure
|
Common Name | 2-(benzylsulfonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 13536-21-5 | Molecular Weight | 276.30800 | |
| Density | 1.351g/cm3 | Boiling Point | 529.9ºC at 760 mmHg | |
| Molecular Formula | C14H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.3ºC | |
| Name | 2-benzylsulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 529.9ºC at 760 mmHg |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.30800 |
| Flash Point | 274.3ºC |
| Exact Mass | 276.04600 |
| PSA | 79.82000 |
| LogP | 3.43950 |
| Vapour Pressure | 4.65E-12mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | GMVRFXQEJYYRMJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)Cc1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
2-(benzylsulfon... CAS#:13536-21-5 |
| Literature: Cohen; Smiles Journal of the Chemical Society, 1930 , p. 406,410 |
|
~%
2-(benzylsulfon... CAS#:13536-21-5 |
| Literature: Lombardino,J.G.; Wiseman,E.H. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 206 - 210 |
|
~%
2-(benzylsulfon... CAS#:13536-21-5 |
| Literature: Lombardino,J.G.; Wiseman,E.H. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 206 - 210 |
![Benzoic acid,2-[(phenylmethyl)thio]- structure](https://image.chemsrc.com/caspic/460/1531-80-2.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| benzylsulfonylbenzoic acid |
| 2-Phenylmethansulfonyl-benzoesaeure |
| 2-phenylmethanesulfonyl-benzoic acid |
| 2-Benzylsulfon-benzoesaeure |
| Benzoic acid,2-benzylsulfonyl |