(1Z)-N-[phenyl(propoxy)phosphoryl]oxyethanimidoyl chloride
Modify Date: 2025-11-13 13:25:05
![(1Z)-N-[phenyl(propoxy)phosphoryl]oxyethanimidoyl chloride Structure](https://image.chemsrc.com/caspic/213/135289-99-5.png)
(1Z)-N-[phenyl(propoxy)phosphoryl]oxyethanimidoyl chloride structure
|
Common Name | (1Z)-N-[phenyl(propoxy)phosphoryl]oxyethanimidoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 135289-99-5 | Molecular Weight | 275.66800 | |
| Density | 1.22g/cm3 | Boiling Point | 338.7ºC at 760mmHg | |
| Molecular Formula | C11H15ClNO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.6ºC | |
| Name | (1Z)-N-[phenyl(propoxy)phosphoryl]oxyethanimidoyl chloride |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 338.7ºC at 760mmHg |
| Molecular Formula | C11H15ClNO3P |
| Molecular Weight | 275.66800 |
| Flash Point | 158.6ºC |
| Exact Mass | 275.04800 |
| PSA | 57.70000 |
| LogP | 3.52040 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | DDPDHWREDMXTDA-RAXLEYEMSA-N |
| SMILES | CCCOP(=O)(ON=C(C)Cl)c1ccccc1 |
|
~32%
(1Z)-N-[phenyl(... CAS#:135289-99-5 |
| Literature: Lyashenko, Yu. E.; Sokolov, V. B.; Martynov, I. V. Phosphorus, Sulfur and Silicon and the Related Elements, 1991 , vol. 60, # 1.2 p. 85 - 95 |
|
~%
(1Z)-N-[phenyl(... CAS#:135289-99-5 |
| Literature: Lyashenko, Yu. E.; Sokolov, V. B.; Martynov, I. V. Phosphorus, Sulfur and Silicon and the Related Elements, 1991 , vol. 60, # 1.2 p. 85 - 95 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |