1-(4-fluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione
Modify Date: 2025-09-23 22:07:21
1-(4-fluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione structure
|
Common Name | 1-(4-fluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 135276-47-0 | Molecular Weight | 258.24400 | |
| Density | 1.294g/cm3 | Boiling Point | 432.6ºC at 760 mmHg | |
| Molecular Formula | C15H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | 1-(4-fluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione |
|---|
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 432.6ºC at 760 mmHg |
| Molecular Formula | C15H11FO3 |
| Molecular Weight | 258.24400 |
| Flash Point | 215.4ºC |
| Exact Mass | 258.06900 |
| PSA | 54.37000 |
| LogP | 2.98700 |
| Vapour Pressure | 4.32E-08mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | LCNADOUVNLWSDQ-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccccc1O)c1ccc(F)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |