N-methyl-1-(4-nitrophenoxy)-N-(4-nitrophenyl)methanethioamide structure
|
Common Name | N-methyl-1-(4-nitrophenoxy)-N-(4-nitrophenyl)methanethioamide | ||
|---|---|---|---|---|
| CAS Number | 13522-36-6 | Molecular Weight | 333.31900 | |
| Density | 1.484g/cm3 | Boiling Point | 501.6ºC at 760 mmHg | |
| Molecular Formula | C14H11N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.2ºC | |
| Name | O-(4-nitrophenyl) N-methyl-N-(4-nitrophenyl)carbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.484g/cm3 |
|---|---|
| Boiling Point | 501.6ºC at 760 mmHg |
| Molecular Formula | C14H11N3O5S |
| Molecular Weight | 333.31900 |
| Flash Point | 257.2ºC |
| Exact Mass | 333.04200 |
| PSA | 136.20000 |
| LogP | 4.34950 |
| Vapour Pressure | 3.43E-10mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | FDLQPHFHUREKHC-UHFFFAOYSA-N |
| SMILES | CN(C(=S)Oc1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
N-methyl-1-(4-n... CAS#:13522-36-6 |
| Literature: Newman,M.S.; Karnes,H.A. Journal of Organic Chemistry, 1966 , vol. 31, p. 3980 - 3984 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-Methyl-N-<4-nitro-phenyl>-thiocarbamidsaeure-O-<4-nitro-phenylester> |