morpholin-4-yl-(4-tert-butylphenoxy)methanethione structure
|
Common Name | morpholin-4-yl-(4-tert-butylphenoxy)methanethione | ||
|---|---|---|---|---|
| CAS Number | 13522-33-3 | Molecular Weight | 279.39800 | |
| Density | 1.134g/cm3 | Boiling Point | 370.3ºC at 760 mmHg | |
| Molecular Formula | C15H21NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.8ºC | |
| Name | O-(4-tert-butylphenyl) morpholine-4-carbothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 370.3ºC at 760 mmHg |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.39800 |
| Flash Point | 177.8ºC |
| Exact Mass | 279.12900 |
| PSA | 53.79000 |
| LogP | 2.91790 |
| Vapour Pressure | 1.11E-05mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | MOBJCYPHWFDSRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OC(=S)N2CCOCC2)cc1 |
|
~%
morpholin-4-yl-... CAS#:13522-33-3 |
| Literature: Newman,M.S.; Karnes,H.A. Journal of Organic Chemistry, 1966 , vol. 31, p. 3980 - 3984 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| morpholine-4-carbothioic acid O-(4-tert-butyl-phenyl) ester |
| Morpholino-thioameisensaeure-O-<4-tert-butyl-phenylester> |